01904 488599
Adenosine 5′-Triphosphate Disodium 100
From £110.00 per (ex VAT)
Adenosine 5′-Triphosphate Disodium 100
| Product Code | A6559-25UMO |
|---|---|
| Unit of Measure | 1X25UMOL |
| CAS Number | 917 |
| Synonyms | Atp |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | DICE |
| UNSPSC Code | 41106305 |
| ADRSuff | 1 |
| CAS Number | 987-65-5 |
| Storage Temperature | -20C |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a hazardous substance or mixture according to Regulation (EC) No. 1272/2008. |
| GHS Signal Words | - |
| MDL Number | MFCD00080339 |
| Net Weight | 5000 |
| Synonyms | ATP |
| Tariff Number | 29349990900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=A6559brand=SIGMA |
| Quality Level | 300 |
| foreign activity | DNase, RNase, none detected |
| InChI | 1S/C10H16N5O13P3.2Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20;;/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20);;/q;2*+1/p-2/t4-,6-,7-,10-;;/m1../s1 |
| concentration | 100 mM in H2O (adjusted to pH 7 with Trizma(R)base) |
| InChI key | TTWYZDPBDWHJOR-IDIVVRGQSA-L |
| form | liquid |
| shipped in | dry ice |
| SMILES string | [Na+].[Na+].Nc1ncnc2n(cnc12)[C@@H]3O[C@H](COP(O)(=O)OP([O-])(=O)OP(O)([O-])=O)[C@@H](O)[C@H]3O |
| storage temp. | -20C |
| UNSPSC | 41106305 |
| Molecular Weight | 0.0000 |
Description
Adenosine 5'-Triphosphate Disodium 100