01904 488599
Amoxicillin Crystalline
From £107.03 per (ex VAT)
Amoxicillin Crystalline
| Product Code | A8523-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 26787-78-0 |
| MDL NUMBER | MFCD00056860 |
| EMPIRICAL FORMULA | C16H19N3O5S |
| Molecular Weight | 365.4 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - A8523-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £120.93 |
| 12+ | 15% | £118.15 |
| 36+ | 17% | £115.37 |
| 72+ | 23% | £107.03 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 26787-78-0 |
| Storage Temperature | 2-8C |
| EINECSNo | 248-003-8 |
| Flash Point | Not applicable |
| GHS Categories | Skin Sens. 1,Resp. Sens. 1 |
| GHS Hazard Codes | H317-H334 |
| GHS Hazard Statements | May cause an allergic skin reaction. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P261 - P280 - P342 + P311 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves. If experiencing respiratory symptoms: Call a POISON CENTER or doctor/ physician. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00056860 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.4 |
| Net Weight | 5 |
| R-Phrases | 42/43 |
| RTECSNo | XH8300000 |
| S-Phrases | 22-36/37 |
| Tariff Number | 29411000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=A8523brand=SIGMA |
| Mode of action | cell wall synthesis | interferes |
| Quality Level | 200 |
| storage temp. | 2-8C |
| potency | >=900 mug per mg |
| InChI key | LSQZJLSUYDQPKJ-NJBDSQKTSA-N |
| SMILES string | CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](N)c3ccc(O)cc3)C(=O)N2[C@H]1C(O)=O |
| solubility | 1 M NH4OH: 50 mg/mL |
| form | solid |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| InChI | 1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/t9-,10-,11+,14-/m1/s1 |
Description
Amoxicillin Crystalline