Ampicillin, Anhydrous, 96.0-102.0% (Anh
From £55.13 per (ex VAT)
Ampicillin, Anhydrous, 96.0-102.0% (Anh
| Product Code | A9393-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 69-53-4 |
| MDL NUMBER | MFCD00005175 |
| EMPIRICAL FORMULA | C16H19N3O4S |
| Molecular Weight | 349.4 |
| Synonyms | D-(-)-Alpha-Aminobenzylpenicillin |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - A9393-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £62.29 |
| 12+ | 15% | £60.86 |
| 36+ | 17% | £59.43 |
| 72+ | 23% | £55.13 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 69-53-4 |
| Storage Temperature | 2-8C |
| EINECSNo | 200-709-7 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Skin Sens. 1,Eye Irrit. 2,Resp. Sens. 1,STOT SE 3 |
| GHS Hazard Codes | H315-H317-H319-H334-H335 |
| GHS Hazard Statements | Causes skin irritation. May cause an allergic skin reaction. Causes serious eye irritation. May cause allergy or asthma symptoms or breathing difficulties if inhaled. May cause respiratory irritation. |
| GHS Pictograms | GHS08,GHS07 |
| GHS Precaution Codes | P261 - P280 - P305 + P351 + P338 - P342 + P311 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. If experiencing respiratory symptoms: Call a PO |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00005175 |
| Melting Point | 208 C (dec.) (lit.) |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.4 |
| Net Weight | 5 |
| R-Phrases | 36/37/38-42/43 |
| RTECSNo | XH8350000 |
| S-Phrases | 22-26-36/37 |
| Synonyms | D-(-)-alpha-Aminobenzylpenicillin |
| Tariff Number | 29411000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=A9393brand=SIGMA |
| Mode of action | cell wall synthesis | interferes |
| Quality Level | 200 |
| storage temp. | 2-8C |
| SMILES string | [H][C@]12SC(C)(C)[C@@H](N1C(=O)[C@H]2NC(=O)[C@H](N)c3ccccc3)C(O)=O |
| form | solid |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| pKa (25 C) | 2.5 (COOH) |
| InChI key | AVKUERGKIZMTKX-NJBDSQKTSA-N |
| mp | 208 C (dec.) (lit.) |
| InChI | 1S/C16H19N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1 |
| Assay | 96.0-102.0% (anhydrous basis) |
Description
Ampicillin, Anhydrous, 96.0-102.0% (Anh