Apramycin Sulfate Salt
From £46.35 per (ex VAT)
Apramycin Sulfate Salt
| Product Code | A2024-1G |
|---|---|
| Unit of Measure | 1X1GR |
| CAS Number | 65710-07-8 |
| MDL NUMBER | MFCD06200257 |
| EMPIRICAL FORMULA | C21H41N5O11 |
| Molecular Weight | 539.58 (free base basis) |
| Synonyms | Nebramycin Ii |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - A2024-1G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £52.37 |
| 12+ | 15% | £51.17 |
| 36+ | 17% | £49.97 |
| 72+ | 23% | £46.35 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 65710-07-8 |
| Storage Temperature | 2-8C |
| EINECSNo | 265-890-7 |
| GHS Categories | Repr. 1B |
| GHS Hazard Codes | H360 |
| GHS Hazard Statements | May damage fertility or the unborn child. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P201 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. IF exposed or concerned: Get medical advice/ attention. |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD06200257 |
| Molecular Formula | C21H41N5O11 |
| Net Weight | 1 |
| R-Phrases | 61 |
| S-Phrases | 53-45 |
| Synonyms | Nebramycin II |
| Tariff Number | 29419000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=A2024brand=SIGMA |
| InChI | 1S/C21H41N5O11.H2O4S/c1-26-11-14(30)18-8(33-20(11)37-21-16(32)13(29)10(25)9(4-27)34-21)3-7(24)19(36-18)35-17-6(23)2-5(22)12(28)15(17)31;1-5(2,3)4/h5-21,26-32H,2-4,22-25H2,1H3;(H2,1,2,3,4)/t5-,6+,7-,8+,9-,10-,11+,12+,13+,14-,15-,16-,17-,18+,19+,20-,21-;/m1./s1 |
| Quality Level | 200 |
| storage temp. | 2-8C |
| SMILES string | OS(O)(=O)=O.CN[C@H]1[C@@H](O)[C@H]2O[C@H](O[C@@H]3[C@@H](N)C[C@@H](N)[C@H](O)[C@H]3O)[C@H](N)C[C@@H]2O[C@@H]1O[C@H]4O[C@H](CO)[C@@H](N)[C@H](O)[C@H]4O |
| color | white to brown |
| Mode of action | protein synthesis | interferes |
| Antibiotic Activity Spectrum | Gram-negative bacteria |
| form | powder |
| biological source | Streptomyces tenebrarius |
| InChI key | WGLYHYWDYPSNPF-RQFIXDHTSA-N |
Description
Apramycin Sulfate Salt