Arsenazo Iii, Calcium-Sensitive Dye
From £223.00 per (ex VAT)
Arsenazo Iii, Calcium-Sensitive Dye
| Product Code | A92775-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 1668-00-4 |
| MDL NUMBER | MFCD00036695 |
| EMPIRICAL FORMULA | C22H18As2N4O14S2 |
| Molecular Weight | 776.37 |
| Synonyms | 2,2'-(1,8-Dihydroxy-3,6-Disulfonaphthylene-2,7-Bisazo)Bisbenzenearsonic Acid; 2,7-Bis(2-Arsonophenylazo)Chromotropic Acid |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | B |
| CAS Number | 1668-00-4 |
| ADR Hazard Labels | 6.1 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 60 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Organoarsenic compound, solid, n.o.s. |
| ADRNo | 3465 |
| Storage Temperature | room temp |
| EINECSNo | 216-788-6 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 3,Acute Tox. 3,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H301-H331-H400-H410 |
| GHS Hazard Statements | Toxic if swallowed. Toxic if inhaled. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS06,GHS09 |
| GHS Precaution Codes | P261 - P273 - P301 + P310 - P311 - P501 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Avoid release to the environment. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. Call a POISON CENTER or doctor/ physician. Dispose of contents/ container to an approved waste di |
| GHS Signal Words | Danger |
| Hazard Symbols | T,N |
| Hazard Symbols Descriptions | Toxic, Dangerous for the environment |
| MDL Number | MFCD00036695 |
| Melting Point | >320 C (lit.) |
| Molecular Formula | C22H18As2N4O14S2 |
| Molecular Weight | 776.37 |
| Net Weight | 5 |
| R-Phrases | 23/25-50/53 |
| S-Phrases | 20/21-28-45-60-61 |
| Synonyms | 2,2'-(1,8-Dihydroxy-3,6-disulfonaphthylene-2,7-bisazo)bisbenzenearsonic acid; 2,7-Bis(2-arsonophenylazo)chromotropic acid |
| Tariff Number | 29319000900 |
| Technical Name | ARSENAZO |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=A92775brand=SIAL |
| Quality Level | 200 |
| solubility | ammonium hydroxide: 1 mg/mL |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| lambdamax | 530 nm |
| mp | >320 C (lit.) |
| impurities | <0.1% Ca |
| SMILES string | Oc1c(N=Nc2ccccc2[As](O)(O)=O)c(cc3cc(c(N=Nc4ccccc4[As](O)(O)=O)c(O)c13)S(O)(=O)=O)S(O)(=O)=O |
| InChI key | UQHVTNUJRKELCE-NBHCHVEOSA-N |
| form | powder |
| technique(s) | titration: suitable |
| InChI | 1S/C22H18As2N4O14S2/c29-21-18-11(9-16(43(37,38)39)19(21)27-25-14-7-3-1-5-12(14)23(31,32)33)10-17(44(40,41)42)20(22(18)30)28-26-15-8-4-2-6-13(15)24(34,35)36/h1-10,29-30H,(H2,31,32,33)(H2,34,35,36)(H,37,38,39)(H,40,41,42)/b27-25+,28-26+ |
Description
Arsenazo Iii, Calcium-Sensitive Dye