Bis(Trimethylsilyl)Trifluoroacetamide (B
From £839.30 per (ex VAT)
Bis(Trimethylsilyl)Trifluoroacetamide (B
| Product Code | T6381-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 25561-30-2 |
| MDL NUMBER | MFCD00008269 |
| EMPIRICAL FORMULA | C8H18F3NOSi2 |
| Molecular Weight | 257.4 |
| Synonyms | Bstfa + Tmcs |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12000000 |
| ADRSuff | BA |
| CAS Number | 25561-30-2 |
| ADR Hazard Labels | 3 |
| ADR Number of Danger | 338 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Flammable liquid, corrosive, n.o.s. |
| ADR SubHaz Classes | 8 |
| ADRNo | 2924 |
| Boiling Point | 45-50 C/14 mmHg (lit.) |
| Storage Temperature | 2-8C |
| Density | 0.97 g/mL (lit.) |
| Flash Point | 6.7 C - closed cup |
| GHS Categories | Flam. Liq. 2,Skin Corr. 1B |
| GHS Hazard Codes | H225-H314 |
| GHS Hazard Statements | Highly flammable liquid and vapour. Causes severe skin burns and eye damage. |
| GHS Pictograms | GHS02,GHS05 |
| GHS Precaution Codes | P210 - P280 - P305 + P351 + P338 - P310 |
| GHS Precaution Statements | Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/ protective clothing/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. |
| GHS Signal Words | Danger |
| Hazard Symbols | F,C |
| Hazard Symbols Descriptions | Highly flammable, Corrosive |
| MDL Number | MFCD00008269 |
| Molecular Formula | C8H18F3NOSi2 |
| Molecular Weight | 257.4 |
| Net Weight | 100 |
| R-Phrases | Nov-34 |
| S-Phrases | 16-26-36/37/39-45 |
| Synonyms | BSTFA + TMCS |
| Tariff Number | 38249992990 |
| Technical Name | N,O-BIS(TRIMETHYLSILYL)TRIFLUOROACETAMIDE WITH TRIMETHYLCHLOROSILANE |
| reaction suitability | reagent type: derivatization reagentreaction type: Silylations |
| bp | 45-50 C/14 mmHg (lit.) |
| storage temp. | 2-8C |
| quality | with 1% trimethylchlorosilane |
| solubility | hexane: miscible 100 mg/mL |
| color | hazy clear to colorless |
| SMILES string | C[Si](C)(C)OC(=N[Si](C)(C)C)C(F)(F)F |
| technique(s) | gas chromatography (GC): suitable |
| grade | for GC derivatization |
| contains | 1% trimethylchlorosilane as additive |
| refractive index | n20/D 1.384 (lit.) |
| InChI | 1S/C8H18F3NOSi2/c1-14(2,3)12-7(8(9,10)11)13-15(4,5)6/h1-6H3/b12-7+ |
| InChI key | XCOBLONWWXQEBS-KPKJPENVSA-N |
| Quality Level | 100 |
Description
Bis(Trimethylsilyl)Trifluoroacetamide (B