01904 488599
Borax Solution, 5 G/Dl In Deionized
From £59.90 per (ex VAT)
Borax Solution, 5 G/Dl In Deionized
| Product Code | HT1002-100ML |
|---|---|
| Unit of Measure | 1X100ML |
| MDL NUMBER | MFCD00081185 |
| Synonyms | Sodium Borate Solution |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | BA |
| ADR Hazard Labels | 8 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 80 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 8 |
| ADR Proper Shipping Name | Corrosive liquid, n.o.s. |
| ADRNo | 1760 |
| Storage Temperature | room temp |
| Flash Point | Not applicable |
| GHS Categories | Repr. 1B |
| GHS Hazard Codes | H360FD |
| GHS Hazard Statements | May damage fertility. May damage the unborn child. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P201 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. IF exposed or concerned: Get medical advice/ attention. |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00081185 |
| Net Weight | 100 |
| R-Phrases | 60-61 |
| S-Phrases | 53-45 |
| Synonyms | Sodium borate solution |
| Tariff Number | 28401990000 |
| Technical Name | BORAX SOLUTION |
| concentration | 5 g/dL in deionized water |
| InChI | 1S/B4O7.2Na/c5-1-7-3-9-2(6)10-4(8-1)11-3;;/q-2;2*+1 |
| InChI key | UQGFMSUEHSUPRD-UHFFFAOYSA-N |
| pH | 8.9-9.6 |
| Quality Level | 500 |
| storage temp. | room temp |
| shelf life | Expiry date on the label. |
| IVD | for in vitro diagnostic use |
| form | solution |
| Application(s) | hematologyhistology |
| SMILES string | [Na+].[Na+].[O-]B1Ob2ob([O-])ob(O1)o2 |
Description
Borax Solution, 5 G/Dl In Deionized