01904 488599
Carbenicillin Disodium Salt Bioreagent
From £287.76 per (ex VAT)
Carbenicillin Disodium Salt Bioreagent
| Product Code | C3416-1G |
|---|---|
| Unit of Measure | 1X1GR |
| CAS Number | 4800-94-6 |
| MDL NUMBER | MFCD00077683 |
| EMPIRICAL FORMULA | C17H16N2Na2O6S |
| Molecular Weight | 422.36 |
| Synonyms | Alpha-Carboxybenzylpenicillin Disodium Salt |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - C3416-1G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £300.84 |
| 12+ | 10% | £294.30 |
| 36+ | 12% | £287.76 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 4800-94-6 |
| Storage Temperature | 2-8C |
| EINECSNo | 225-360-8 |
| Flash Point | Not applicable |
| GHS Categories | Skin Sens. 1,Resp. Sens. 1 |
| GHS Hazard Codes | H317-H334 |
| GHS Hazard Statements | May cause an allergic skin reaction. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P261 - P280 - P342 + P311 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves. If experiencing respiratory symptoms: Call a POISON CENTER or doctor/ physician. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00077683 |
| Molecular Formula | C17H16N2Na2O6S |
| Molecular Weight | 422.36 |
| Net Weight | 1 |
| R-Phrases | 42/43 |
| RTECSNo | ON9105000 |
| S-Phrases | 22-36/37 |
| Synonyms | alpha-Carboxybenzylpenicillin disodium salt |
| Tariff Number | 29411000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=C3416brand=SIGMA |
| Mode of action | cell wall synthesis | interferes |
| Quality Level | 200 |
| storage temp. | 2-8C |
| technique(s) | cell culture | plant: suitable |
| product line | BioReagent |
| InChI | 1S/C17H18N2O6S.2Na/c1-17(2)11(16(24)25)19-13(21)10(14(19)26-17)18-12(20)9(15(22)23)8-6-4-3-5-7-8;;/h3-7,9-11,14H,1-2H3,(H,18,20)(H,22,23)(H,24,25);;/q;2*+1/p-2/t9?,10-,11+,14-;;/m1../s1 |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| form | powder |
| SMILES string | [Na+].[Na+].CC1(C)S[C@@H]2[C@H](NC(=O)C(C([O-])=O)c3ccccc3)C(=O)N2[C@H]1C([O-])=O |
| Application(s) | agriculture |
| solubility | H2O: 50 mg/mL |
| InChI key | RTYJTGSCYUUYAL-YCAHSCEMSA-L |
Description
Carbenicillin Disodium Salt Bioreagent