(-)-Caryophyllene Oxide, 95%
From £1,430.00 per (ex VAT)
(-)-Caryophyllene Oxide, 95%
| Product Code | W509647-5KG |
|---|---|
| Unit of Measure | 1X5KG |
| CAS Number | 1139-30-6 |
| MDL NUMBER | MFCD00134216 |
| EMPIRICAL FORMULA | C15H24O |
| Molecular Weight | 220.35 |
| Synonyms | Beta-Caryophyllene Epoxide; (-)-Epoxycaryophyllene; (-)-Epoxydihydrocaryophyllene; (1R,4R,6R,10S)-9-Methylene-4,12,12-Trimethyl-5-Oxatricyclo[8.2.0.04,6]Dodecane; Trans-Caryophyllene Oxide |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12164502 |
| ADRSuff | 1 |
| CAS Number | 1139-30-6 |
| EINECSNo | 214-519-7 |
| Flash Point | 110 C - closed cup |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2 |
| GHS Hazard Codes | H315-H319 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P305 + P351 + P338 |
| GHS Precaution Statements | IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00134216 |
| Melting Point | 62-63 C (lit.) |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| Net Weight | 5 |
| Purity Grade | 0.95 |
| R-Phrases | 36/38 |
| RTECSNo | RP5530000 |
| S-Phrases | 26 |
| Synonyms | beta-Caryophyllene epoxide; (-)-Epoxycaryophyllene; (-)-Epoxydihydrocaryophyllene; (1R,4R,6R,10S)-9-Methylene-4,12,12-trimethyl-5-oxatricyclo[8.2.0.04,6]dodecane; trans-Caryophyllene oxide |
| Tariff Number | 29109000900 |
| optical activity | [alpha]20/D -70, c = 2 in chloroform |
| Application(s) | flavors and fragrances |
| Quality Level | 400 |
| food allergen | no known allergens |
| biological source | synthetic |
| reg. compliance | EU Regulation 1223/2009 |
| Assay | 95% |
| mp | 62-63 C (lit.) |
| Organoleptic | woody |
| SMILES string | [H][C@@]12CCC(=C)[C@@]3([H])CC(C)(C)[C@]3([H])CC[C@@]1(C)O2 |
| InChI key | NVEQFIOZRFFVFW-RGCMKSIDSA-N |
| Documentation | see Safety & Documentation for available documents |
| InChI | 1S/C15H24O/c1-10-5-6-13-15(4,16-13)8-7-12-11(10)9-14(12,2)3/h11-13H,1,5-9H2,2-4H3/t11-,12-,13-,15-/m1/s1 |
| agency | follows IFRA guidelines |
| fragrance allergen | beta-caryophyllene (ox.) |
Description
(-)-Caryophyllene Oxide, 95%