01904 488599
Cis-4-Decenal, >=93%, Stabilized, Fg
From £65.30 per (ex VAT)
Cis-4-Decenal, >=93%, Stabilized, Fg
| Product Code | W326402-SAMPLE-K |
|---|---|
| Unit of Measure | 1XEA |
| CAS Number | 21662-09-9 |
| MDL NUMBER | MFCD00007024 |
| EMPIRICAL FORMULA | CH18O |
| Molecular Weight | 154.25 |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12164502 |
| ADRSuff | 1 |
| CAS Number | 21662-09-9 |
| Boiling Point | 78-80 C/10 mmHg (lit.) |
| Density | 0.847 g/mL at 25 C (lit.) |
| EINECSNo | 244-514-5 |
| Flash Point | 82 C - closed cup |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00007024 |
| Molecular Formula | CH18O |
| Molecular Weight | 154.25 |
| Net Weight | 10 |
| R-Phrases | 36/37/38 |
| RTECSNo | HE2071400 |
| S-Phrases | 26-36/37/39 |
| Tariff Number | 29121900900 |
| Technical Name | CIS-4-DECENAL |
| Application(s) | flavors and fragrances |
| Quality Level | 400 |
| food allergen | no known allergens |
| biological source | synthetic |
| refractive index | n20/D 1.443 (lit.) |
| grade | FG |
| reg. compliance | FDA 21 CFR 172.515 |
| InChI | 1S/C10H18O/c1-2-3-4-5-6-7-8-9-10-11/h6-7,10H,2-5,8-9H2,1H3/b7-6- |
| bp | 78-80 C/10 mmHg (lit.) |
| Documentation | see Safety & Documentation for available documents |
| Assay | >=93% |
| Organoleptic | orange; citrus |
| SMILES string | [H]C(=O)CCC([H])=C([H])CCCCC |
| contains | synthetic alpha-tocopherol as stabilizer |
| InChI key | CWRKZMLUDFBPAO-SREVYHEPSA-N |
Description
Cis-4-Decenal, >=93%, Stabilized, Fg