01904 488599
Cypermethrin (Mixture Of Isomers), Pesta
From £71.20 per (ex VAT)
Cypermethrin (Mixture Of Isomers), Pesta
| Product Code | 36128-100MG |
|---|---|
| Unit of Measure | 1X100MG |
| CAS Number | 52315-07-8 |
| MDL NUMBER | MFCD00055328 |
| EMPIRICAL FORMULA | C22H19Cl2NO3 |
| Molecular Weight | 416.3 |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | CN |
| CAS Number | 52315-07-8 |
| ADR Hazard Labels | 6.1 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 60 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic liquid, organic, n.o.s. |
| ADRNo | 2810 |
| EINECSNo | 257-842-9 |
| Flash Point | 100 C - closed cup |
| GHS Categories | Acute Tox. 3,Skin Irrit. 2,Skin Sens. 1,Acute Tox. 4,STOT SE 3,STOT RE 2,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H301-H315-H317-H332-H335-H373-H400-H410 |
| GHS Hazard Statements | Toxic if swallowed. Causes skin irritation. May cause an allergic skin reaction. Harmful if inhaled. May cause respiratory irritation. May cause damage to organs through prolonged or repeated exposure. Very toxic to aquatic life. Very toxic to aquatic lif |
| GHS Pictograms | GHS06,GHS08,GHS09 |
| GHS Precaution Codes | P260 - P280 - P301 + P330 + P331 + P310 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Avoid release to the environment. Dispose of contents/ container to an approved waste disposal plant. |
| GHS Signal Words | Danger |
| Hazard Symbols | T,N |
| Hazard Symbols Descriptions | Toxic, Dangerous for the environment |
| MDL Number | MFCD00055328 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.3 |
| Net Weight | 100 |
| R-Phrases | 20-25-37/38-43-48/22-50/53 |
| S-Phrases | 36/37-45-60-61 |
| Tariff Number | 29269070170 |
| Technical Name | CYPERMETHRIN |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=36128brand=SIAL |
| InChI | 1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3 |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2 |
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| refractive index | n20/D 1.57 |
| grade | analytical standard |
| Quality Level | 100 |
| Application(s) | agricultureenvironmental |
| product line | PESTANAL(R) |
| suitability | passes test for identity (NMR) |
| InChI key | KAATUXNTWXVJKI-UHFFFAOYSA-N |
| description | mixture of isomers |
Description
Cypermethrin (Mixture Of Isomers), Pesta