Dess-Martin Periodinane, 97%
From £547.76 per (ex VAT)
Dess-Martin Periodinane, 97%
| Product Code | 274623-50G |
|---|---|
| Unit of Measure | 1X50GR |
| CAS Number | 87413-09-0 |
| MDL NUMBER | MFCD00130127 |
| EMPIRICAL FORMULA | C13H13IO8 |
| Molecular Weight | 424.14 |
| Synonyms | 1,1,1-Tris(Acetyloxy)-1,1-Dihydro-1,2-Benziodoxol-3-(1H)-One |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STDI |
| UNSPSC Code | 12352000 |
| ADRSuff | C |
| CAS Number | 87413-09-0 |
| ADR Hazard Labels | 5.1 |
| ADR Number of Danger | 50 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 5.1 |
| ADR Proper Shipping Name | Oxidizing solid, n.o.s. |
| ADRNo | 1479 |
| Storage Temperature | -20C |
| Flash Point | Not applicable |
| GHS Categories | Ox. Sol. 2,Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H272-H315-H319-H335 |
| GHS Hazard Statements | May intensify fire; oxidiser. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS03,GHS07 |
| GHS Precaution Codes | P210 - P220 - P221 - P305 + P351 + P338 - P370 + P378 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ protective clothing. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Danger |
| Hazard Symbols | O,Xn |
| Hazard Symbols Descriptions | Oxidising, Harmful |
| MDL Number | MFCD00130127 |
| Melting Point | 130-133 C (lit.) |
| Molecular Formula | C13H13IO8 |
| Molecular Weight | 424.14 |
| Net Weight | 0.05 |
| Purity Grade | 0.97 |
| R-Phrases | 8-20/21/22-36/37/38-44 |
| S-Phrases | 26-36 |
| Synonyms | 1,1,1-Tris(acetyloxy)-1,1-dihydro-1,2-benziodoxol-3-(1H)-one |
| Tariff Number | 29349990900 |
| Technical Name | 1,1,1-Tris(acetyloxy)-1,1-dihydro-1,2-benziodoxol-3-(1H)-one |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=274623brand=ALDRICH |
| Assay | 97% |
| InChI | 1S/C13H13IO8/c1-8(15)19-14(20-9(2)16,21-10(3)17)12-7-5-4-6-11(12)13(18)22-14/h4-7H,1-3H3 |
| storage temp. | -20C |
| Quality Level | 100 |
| reaction suitability | reagent type: oxidant |
| InChI key | NKLCNNUWBJBICK-UHFFFAOYSA-N |
| mp | 130-133 C (lit.) |
| SMILES string | CC(=O)OI1(OC(C)=O)(OC(C)=O)OC(=O)c2ccccc12 |
Description
Dess-Martin Periodinane, 97%