01904 488599
Dioctyl Phthalate, >=99.5%
From £149.00 per (ex VAT)
Dioctyl Phthalate, >=99.5%
| Product Code | D201154-2.5L |
|---|---|
| Unit of Measure | 1X2.5LT |
| CAS Number | 117-81-7 |
| MDL NUMBER | MFCD00009493 |
| EMPIRICAL FORMULA | C24H38O4 |
| Molecular Weight | 390.56 |
| Synonyms | Bis(2-Ethylhexyl) Phthalate; Dehp; Dop; Phthalic Acid Bis(2-Ethylhexyl Ester) |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32030000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | 1 |
| CAS Number | 117-81-7 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 90 |
| Boiling Point | 384 C (lit.) |
| Density | 0.985-0.987 g/mL at 20 C; 0.985 g/mL at 25 C (lit.) |
| EINECSNo | 204-211-0 |
| Flash Point | 207 C - closed cup |
| GHS Categories | Repr. 1B |
| GHS Hazard Codes | H360FD |
| GHS Hazard Statements | May damage fertility. May damage the unborn child. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P201 - P280 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. IF exposed or concerned: Get medical advice/ attention. |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00009493 |
| Melting Point | -50 C (lit.) |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 |
| Net Weight | 2.452 |
| R-Phrases | 60-61 |
| RTECSNo | TI0350000 |
| S-Phrases | 53-45 |
| Synonyms | Bis(2-ethylhexyl) phthalate; DEHP; DOP; Phthalic acid bis(2-ethylhexyl ester) |
| Tariff Number | 29173200100 |
| Technical Name | DIOCTYL PHTHALATE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=D201154brand=ALDRICH |
| Quality Level | 200 |
| refractive index | n25/D 1.483-1.487 |
| vapor pressure | 1.2 mmHg ( 93 C) |
| Assay | >=99.5% |
| InChI | 1S/C24H38O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3 |
| vapor density | >16 (vs air) |
| bp | 384 C (lit.) |
| impurities | <=0.05% water (Karl Fischer) |
| suitability | suitable for acidity (<= 0.003 % as phthalic acid) |
| mp | -50 C (lit.) |
| color | APHA: <=10 |
| form | oil |
| SMILES string | CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC |
| InChI key | BJQHLKABXJIVAM-UHFFFAOYSA-N |
| autoignition temp. | 734 F |
Description
Dioctyl Phthalate, >=99.5%