01904 488599
Doxorubicin Hydrochloride Suitable For
£63.60 Each (ex VAT)
Doxorubicin Hydrochloride Suitable For
| Product Code | 44583-1MG |
|---|---|
| Unit of Measure | 1X1MG |
| CAS Number | 25316-40-9 |
| MDL NUMBER | MFCD00077757 |
| EMPIRICAL FORMULA | C27H29NO11 |
| Molecular Weight | 579.98 |
| Synonyms | Dox; Hydroxydaunorubicin Hydrochloride |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 25316-40-9 |
| Storage Temperature | 2-8C |
| EINECSNo | 246-818-3 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Skin Irrit. 2,Eye Irrit. 2,Carc. 1B |
| GHS Hazard Codes | H302-H315-H319-H350 |
| GHS Hazard Statements | Harmful if swallowed. Causes skin irritation. Causes serious eye irritation. May cause cancer. |
| GHS Pictograms | GHS08,GHS07 |
| GHS Precaution Codes | P201 - P305 + P351 + P338 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. IF exposed or concerned: Get medical advice/ attention. |
| GHS Signal Words | Danger |
| Hazard Symbols | T,Xi |
| Hazard Symbols Descriptions | Toxic, Irritant |
| MDL Number | MFCD00077757 |
| Melting Point | 216 C (dec.) (lit.) |
| Molecular Formula | C27H29NO11 |
| Molecular Weight | 579.98 |
| Net Weight | 1 |
| R-Phrases | 45-22-36/38 |
| RTECSNo | QI9295900 |
| S-Phrases | 53-45 |
| Synonyms | DOX; Hydroxydaunorubicin hydrochloride |
| Tariff Number | 29419000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=44583brand=SIGMA |
| solubility | H2O: 50 mg/mL, clear, orange to red |
| mp | 216 C (dec.) (lit.) |
| Antibiotic Activity Spectrum | neoplastics |
| Quality Level | 200 |
| Gene Information | human ... TOP2A(7153) |
| storage temp. | 2-8C |
| color | orange to dark red |
| fluorescence | lambdaex 470 nm; lambdaem 585 nm in ethanol |
| SMILES string | Cl[H].COc1cccc2C(=O)c3c(O)c4C[C@](O)(C[C@H](O[C@H]5C[C@H](N)[C@H](O)[C@H](C)O5)c4c(O)c3C(=O)c12)C(=O)CO |
| biological source | synthetic |
| Assay | 98.0-102.0% (HPLC) |
| form | solid |
| Mode of action | enzyme | inhibits |
| InChI key | MWWSFMDVAYGXBV-RUELKSSGSA-N |
| suitability | suitable for fluorescence |
| InChI | 1S/C27H29NO11.ClH/c1-10-22(31)13(28)6-17(38-10)39-15-8-27(36,16(30)9-29)7-12-19(15)26(35)21-20(24(12)33)23(32)11-4-3-5-14(37-2)18(11)25(21)34;/h3-5,10,13,15,17,22,29,31,33,35-36H,6-9,28H2,1-2H3;1H/t10-,13-,15-,17-,22+,27-;/m0./s1 |
Description
Doxorubicin Hydrochloride Suitable For