Fenchyl Alcohol, >=96%, Fg
From £347.00 per (ex VAT)
Fenchyl Alcohol, >=96%, Fg
| Product Code | W248010-5KG-K |
|---|---|
| Unit of Measure | 1X5KG |
| CAS Number | 1632-73-1 |
| MDL NUMBER | MFCD00003760 |
| EMPIRICAL FORMULA | CH18O |
| Molecular Weight | 154.25 |
| Synonyms | Fenchol |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12164502 |
| ADRSuff | 1 |
| CAS Number | 1632-73-1 |
| EINECSNo | 216-639-5 |
| Flash Point | 74 C - closed cup |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00003760 |
| Melting Point | 39.0-45.0 C (lit.) |
| Molecular Formula | CH18O |
| Molecular Weight | 154.25 |
| Net Weight | 5 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26 |
| Synonyms | Fenchol |
| Tariff Number | 29061900900 |
| Application(s) | flavors and fragrances |
| Quality Level | 400 |
| food allergen | no known allergens |
| biological source | synthetic |
| reg. compliance | FDA 21 CFR 117 |
| grade | FG |
| InChI | 1S/C10H18O/c1-9(2)7-4-5-10(3,6-7)8(9)11/h7-8,11H,4-6H2,1-3H3/t7-,8-,10+/m0/s1 |
| mp | 39.0-45.0 C (lit.) |
| Assay | >=96% |
| Organoleptic | earthy; camphoraceous; pine |
| SMILES string | [H][C@]12CC[C@](C)(C1)[C@@H](O)C2(C)C |
| InChI key | IAIHUHQCLTYTSF-OYNCUSHFSA-N |
| Documentation | see Safety & Documentation for available documents |
Description
Fenchyl Alcohol, >=96%, Fg