01904 488599
Flurbiprofen, Cyclooxygenase Inhibitor
From £55.83 per (ex VAT)
Flurbiprofen, Cyclooxygenase Inhibitor
| Product Code | F8514-1G |
|---|---|
| Unit of Measure | 1X1GR |
| CAS Number | 5104-49-4 |
| MDL NUMBER | MFCD00079303 |
| EMPIRICAL FORMULA | C15H13FO2 |
| Molecular Weight | 244.26 |
| Synonyms | (+/-)-2-Fluoro-alpha-methyl-4-biphenylacetic acid; L-790,330 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - F8514-1G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £63.08 |
| 12+ | 15% | £61.63 |
| 36+ | 17% | £60.18 |
| 72+ | 23% | £55.83 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | C |
| CAS Number | 5104-49-4 |
| ADR Hazard Labels | 6.1 |
| ADR Number of Danger | 60 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic solid, organic, n.o.s. |
| ADRNo | 2811 |
| EINECSNo | 225-827-6 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 3 |
| GHS Hazard Codes | H301 |
| GHS Hazard Statements | Toxic if swallowed. |
| GHS Pictograms | GHS06 |
| GHS Precaution Codes | P301 + P310 |
| GHS Precaution Statements | IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00079303 |
| Melting Point | 110-112 C (lit.) |
| Molecular Formula | C15H13FO2 |
| Molecular Weight | 244.26 |
| Net Weight | 1 |
| R-Phrases | 25 |
| RTECSNo | DU8341000 |
| S-Phrases | 36/37/39-45 |
| Synonyms | (+/-)-2-Fluoro-alpha-methyl-4-biphenylacetic acid; L-790,330 |
| Tariff Number | 29163990900 |
| Technical Name | FLURBIPROFEN |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=F8514brand=SIGMA |
| Antibiotic Activity Spectrum | fungi |
| Gene Information | human ... ALB(213), APP(351), CYP1A2(1544), CYP2C9(1559), PTGS1(5742), PTGS2(5743)rat ... Ptgs1(24693) |
| biological source | synthetic |
| mp | 110-112 C (lit.) |
| InChI key | SYTBZMRGLBWNTM-UHFFFAOYSA-N |
| Mode of action | enzyme | inhibits |
| InChI | 1S/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18) |
| form | powder |
| solubility | methanol: 50 mg/mL |
| Assay | >=98.5% (HPLC) |
| SMILES string | CC(C(O)=O)c1ccc(c(F)c1)-c2ccccc2 |
| Quality Level | 100 |
| color | white to off-white |
Description
Flurbiprofen, Cyclooxygenase Inhibitor