01904 488599
Geranyl Propionate, Fcc
From £152.00 per (ex VAT)
Geranyl Propionate, Fcc
| Product Code | W251704-1KG-K |
|---|---|
| Unit of Measure | 1X1KG |
| CAS Number | 105-90-8 |
| MDL NUMBER | MFCD00027009 |
| EMPIRICAL FORMULA | C13H22O2 |
| Molecular Weight | 210.31 |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12164502 |
| ADRSuff | 1 |
| CAS Number | 105-90-8 |
| Boiling Point | 252 C/738 mmHg (lit.) |
| Density | 0.899 g/mL at 25 C (lit.) |
| EINECSNo | 203-344-1 |
| Flash Point | 113 C |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P280 - P304 + P340 + P312 - P305 + P351 + P338 - P337 + P313 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00027009 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.31 |
| Net Weight | 1 |
| R-Phrases | 36/37/38 |
| RTECSNo | RG5927906 |
| S-Phrases | 26-36 |
| Tariff Number | 29155000000 |
| Application(s) | flavors and fragrances |
| Quality Level | 400 |
| food allergen | no known allergens |
| refractive index | n20/D 1.456 (lit.) |
| biological source | synthetic |
| reg. compliance | FDA 21 CFR 117 |
| grade | FG |
| fragrance allergen | geraniol |
| Organoleptic | tropical; floral; waxy; rose |
| bp | 252 C/738 mmHg (lit.) |
| description | Fragrance Allergen: Geraniol <2% |
| Assay | >95% |
| InChI key | BYCHQEILESTMQU-FMIVXFBMSA-N |
| Documentation | see Safety & Documentation for available documents |
| agency | follows IFRA guidelines |
| InChI | 1S/C13H22O2/c1-5-13(14)15-10-9-12(4)8-6-7-11(2)3/h7,9H,5-6,8,10H2,1-4H3/b12-9+ |
| SMILES string | CCC(=O)OCC=C(/C)CCC=C(C)C |
Description
Geranyl Propionate, Fcc