01904 488599
Indigocarmine, For Microscopy
From £28.39 per (ex VAT)
Indigocarmine, For Microscopy
| Product Code | 57000-25G-F |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 860-22-0 |
| MDL NUMBER | MFCD00005723 |
| EMPIRICAL FORMULA | C16H8N2Na2O8S2 |
| Molecular Weight | 466.35 |
| Synonyms | Acid Blue 74; Indigo-5,5'-Disulfonic Acid Disodium Salt; Indigocarmine |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 57000-25G-F
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £29.75 |
| 12+ | 15% | £29.07 |
| 36+ | 17% | £28.39 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 860-22-0 |
| Storage Temperature | room temp |
| Density | 0.71 g/cm3 at 29 C |
| EINECSNo | 212-728-8 |
| GHS Categories | Acute Tox. 4 |
| GHS Hazard Codes | H302 |
| GHS Hazard Statements | Harmful if swallowed. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | - |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00005723 |
| Melting Point | >340 C |
| Molecular Formula | C16H8N2Na2O8S2 |
| Molecular Weight | 466.35 |
| Net Weight | 25 |
| R-Phrases | 22 |
| RTECSNo | DU3000000 |
| S-Phrases | 22-24/25 |
| Synonyms | Acid Blue 74; Indigo-5,5'-disulfonic acid disodium salt; Indigocarmine |
| Tariff Number | 32129000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=57000brand=SIGMA |
| pH | 3.87 (30 C, 7.14 g/L) |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| loss | <=5% loss on drying |
| Quality Level | 100 |
| SMILES string | [Na+].[Na+].[O-]S(=O)(=O)c1ccc2NC(C(=O)c2c1)=C3Nc4ccc(cc4C3=O)S([O-])(=O)=O |
| grade | for microscopy (Bact., Hist.) |
| InChI | 1S/C16H10N2O8S2.2Na/c19-15-9-5-7(27(21,22)23)1-3-11(9)17-13(15)14-16(20)10-6-8(28(24,25)26)2-4-12(10)18-14;;/h1-6,17-18H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2/b14-13+;; |
| epsilonmax | >=350 at 603-613 nm |
| form | powder |
| mp | >340 C |
| InChI key | KHLVKKOJDHCJMG-QDBORUFSSA-L |
| solubility | methanol: 0.01 g/10 mL, blue to very deep blue |
Description
Indigocarmine, For Microscopy