L-Menthol, >=99%, Fcc, Fg
From £346.00 per (ex VAT)
L-Menthol, >=99%, Fcc, Fg
| Product Code | W266590-4KG-K |
|---|---|
| Unit of Measure | 1X4KG |
| CAS Number | 2216-51-5 |
| MDL NUMBER | MFCD00062979 |
| EMPIRICAL FORMULA | CH2O |
| Molecular Weight | 156.27 |
| Synonyms | (1R,2S,5R)-(-)-Menthol; (-)-Menthol; (1R,2S,5R)-2-Isopropyl-5-Methylcyclohexanol; 5-Methyl-2-(1-Methylethyl)Cyclohexanol |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12164502 |
| ADRSuff | 1 |
| CAS Number | 2216-51-5 |
| Boiling Point | 212 C (lit.) |
| Density | 0.89 g/mL at 25 C (lit.) |
| EINECSNo | 218-690-9 |
| Flash Point | 94 C - closed cup |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00062979 |
| Melting Point | 41-45 C (lit.) |
| Molecular Formula | CH2O |
| Molecular Weight | 156.27 |
| Net Weight | 4 |
| R-Phrases | 37/38-41 |
| RTECSNo | OT0700000 |
| S-Phrases | 26-39 |
| Synonyms | (1R,2S,5R)-(-)-Menthol; (-)-Menthol; (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanol; 5-Methyl-2-(1-methylethyl)cyclohexanol |
| Tariff Number | 29061100000 |
| Application(s) | flavors and fragrances |
| Quality Level | 400 |
| food allergen | no known allergens |
| vapor pressure | 0.8 mmHg ( 20 C) |
| mp | 41-45 C (lit.) |
| biological source | synthetic |
| reg. compliance | FDA 21 CFR 117 |
| grade | FG |
| optical activity | [alpha]22/D -49, c = 10 in 95% ethanol |
| InChI key | NOOLISFMXDJSKH-KXUCPTDWSA-N |
| InChI | 1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| Documentation | see Safety & Documentation for available documents |
| Organoleptic | minty; camphoraceous; cooling |
| bp | 212 C (lit.) |
| Assay | >=99% |
| SMILES string | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
Description
L-Menthol, >=99%, Fcc, Fg