01904 488599
Luperox(R) A75, Benzoyl Peroxide, 75%,
From £33.10 per (ex VAT)
Luperox(R) A75, Benzoyl Peroxide, 75%,
| Product Code | 517909-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 94-36-0 |
| MDL NUMBER | MFCD00003071 |
| EMPIRICAL FORMULA | C14HO4 |
| Molecular Weight | 242.23 |
| Synonyms | Benzoyl Peroxide; Dibenzoyl Peroxide |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32030000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12162002 |
| ADRSuff | 1 |
| CAS Number | 94-36-0 |
| ADR Hazard Labels | 5.2 |
| ADR Primary Hazard Class | 5.2 |
| ADR Proper Shipping Name | Organic peroxide type C, solid |
| ADRNo | 3104 |
| Storage Temperature | 2-8C |
| Flash Point | Not applicable |
| GHS Categories | Org. Perox. C,Skin Sens. 1,Eye Irrit. 2,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H242-H317-H319-H400-H410 |
| GHS Hazard Statements | Heating may cause a fire. May cause an allergic skin reaction. Causes serious eye irritation. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS02,GHS07,GHS09 |
| GHS Precaution Codes | P210 - P220 - P234 - P273 - P280 - P333 + P313 |
| GHS Precaution Statements | Keep/Store away from clothing/ combustible materials. Wear protective gloves/ protective clothing/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rin |
| GHS Signal Words | Danger |
| Hazard Symbols | O,Xi |
| Hazard Symbols Descriptions | Oxidising, Irritant |
| MDL Number | MFCD00003071 |
| Melting Point | 105 C (lit.) |
| Molecular Formula | C14HO4 |
| Molecular Weight | 242.23 |
| Net Weight | 5 |
| R-Phrases | 1-7-36-43 |
| S-Phrases | 7-14-26-35-36/37/39-45-47 |
| Synonyms | Benzoyl peroxide; Dibenzoyl peroxide |
| Tariff Number | 29163200000 |
| Technical Name | DIBENZOYL PEROXIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=517909brand=ALDRICH |
| Quality Level | 200 |
| SMILES string | O=C(OOC(=O)c1ccccc1)c2ccccc2 |
| autoignition temp. | 176 F |
| reaction suitability | reagent type: oxidant |
| storage temp. | 2-8C |
| mp | 105 C (lit.) |
| Assay | 75% |
| InChI | 1S/C14H10O4/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H |
| InChI key | OMPJBNCRMGITSC-UHFFFAOYSA-N |
Description
Luperox(R) A75, Benzoyl Peroxide, 75%,