N-Methyl-Bis(Trifluoroacetamide) Derivat
From £212.52 per (ex VAT)
N-Methyl-Bis(Trifluoroacetamide) Derivat
| Product Code | M0789-10X1ML |
|---|---|
| Unit of Measure | 10X1ML |
| CAS Number | 685-27-8 |
| MDL NUMBER | MFCD00000412 |
| EMPIRICAL FORMULA | C5H3F6NO2 |
| Molecular Weight | 223.07 |
| Synonyms | Mbtfa (N-Methyl-Bis(Trifluoroacetamide)Or Btfa (Bis(Tfa)); Mbtfa |
| Brand | SUPELCO |
Tiered Pricing - M0789-10X1ML
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £240.12 |
| 12+ | 15% | £234.60 |
| 36+ | 17% | £229.08 |
| 72+ | 23% | £212.52 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12000000 |
| ADRSuff | BA |
| CAS Number | 685-27-8 |
| ADR Hazard Labels | 8 |
| ADR Number of Danger | 83 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 8 |
| ADR Proper Shipping Name | Corrosive liquid, flammable, n.o.s. |
| ADR SubHaz Classes | 3 |
| ADRNo | 2920 |
| Boiling Point | 121-122 C (lit.) |
| Storage Temperature | 2-8C |
| Density | 1.547 g/mL at 25 C |
| EINECSNo | 211-680-5 |
| Flash Point | 45 C - closed cup |
| GHS Categories | Flam. Liq. 3,Skin Corr. 1B |
| GHS Hazard Codes | H226-H314 |
| GHS Hazard Statements | Flammable liquid and vapour. Causes severe skin burns and eye damage. |
| GHS Pictograms | GHS02,GHS05 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 - P310 |
| GHS Precaution Statements | Wear protective gloves/ protective clothing/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/ phys |
| GHS Signal Words | Danger |
| Hazard Symbols | C |
| Hazard Symbols Descriptions | Corrosive |
| MDL Number | MFCD00000412 |
| Molecular Formula | C5H3F6NO2 |
| Molecular Weight | 223.07 |
| Net Weight | 15.69 |
| R-Phrases | Oct-34 |
| S-Phrases | 26-36/37/39-45 |
| Synonyms | MBTFA (N-methyl-bis(trifluoroacetamide)or BTFA (bis(TFA)); MBTFA |
| Tariff Number | 29241900900 |
| Technical Name | N-METHYL-BIS(TRIFLUOROACETAMIDE) DERIVAT |
| InChI | 1S/C5H3F6NO2/c1-12(2(13)4(6,7)8)3(14)5(9,10)11/h1H3 |
| SMILES string | CN(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| storage temp. | 2-8C |
| reaction suitability | reagent type: derivatization reagentreaction type: Acylations |
| Assay | >=97.0% (GC) |
| quality | LiChropur(TM) |
| form | liquid |
| refractive index | n20/D 1.346 (lit.) |
| bp | 121-122 C (lit.) |
| technique(s) | gas chromatography (GC): suitable |
| grade | for GC derivatization |
| suitability | complies for derivatization |
| InChI key | AWGBWLXGUPTXHF-UHFFFAOYSA-N |
| Quality Level | 100 |
Description
N-Methyl-Bis(Trifluoroacetamide) Derivat