N-Methyl-N-(Trimethylsilyl)Trifluoroace
From £253.33 per (ex VAT)
N-Methyl-N-(Trimethylsilyl)Trifluoroace
| Product Code | M7891-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 24589-78-4 |
| MDL NUMBER | MFCD00000411 |
| EMPIRICAL FORMULA | C6H12F3NOSi |
| Molecular Weight | 199.25 |
| Synonyms | N-Trimethylsilyl-N-Methyl Trifluoroacetamide; Mstfa |
| Brand | SUPELCO |
Tiered Pricing - M7891-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £286.23 |
| 12+ | 15% | £279.65 |
| 36+ | 17% | £273.07 |
| 72+ | 23% | £253.33 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352111 |
| ADRSuff | C |
| CAS Number | 24589-78-4 |
| ADR Hazard Labels | 3 |
| ADR Number of Danger | 30 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Flammable liquid, n.o.s. |
| ADRNo | 1993 |
| Boiling Point | 130-132 C (lit.) |
| Storage Temperature | 2-8C |
| Density | 1.07 g/mL at 25 C (lit.); 1.075 g/mL at 25 C (lit.) |
| EINECSNo | 246-331-6 |
| Flash Point | 26 C - closed cup |
| GHS Categories | Flam. Liq. 3,Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H226-H315-H319-H335 |
| GHS Hazard Statements | Flammable liquid and vapour. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS02,GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00000411 |
| Molecular Formula | C6H12F3NOSi |
| Molecular Weight | 199.25 |
| Net Weight | 25 |
| R-Phrases | 10-36/37/38 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| RTECSNo | AC9800000 |
| S-Phrases | 26-36 |
| Synonyms | N-Trimethylsilyl-N-methyl trifluoroacetamide; MSTFA |
| Tariff Number | 29319000900 |
| Technical Name | N-METHYL-N-(TRIMETHYLSILYL)TRIFLUOROACETAMIDE |
| solubility | chloroform: soluble 0.1 mL/mL |
| vapor density | >1 (vs air) |
| storage temp. | 2-8C |
| quality | for silylations, LiChropur(TM) |
| reaction suitability | reaction type: Silylations |
| product line | BioReagent |
| bp | 130-132 C (lit.) |
| InChI | 1S/C6H12F3NOSi/c1-10(12(2,3)4)5(11)6(7,8)9/h1-4H3 |
| form | liquid |
| vapor pressure | 8.8 mmHg ( 27 C) |
| technique(s) | gas chromatography (GC): suitable |
| SMILES string | CN(C(=O)C(F)(F)F)[Si](C)(C)C |
| InChI key | MSPCIZMDDUQPGJ-UHFFFAOYSA-N |
| Quality Level | 100 |
| refractive index | n20/D 1.38 (lit.) |
Description
N-Methyl-N-(Trimethylsilyl)Trifluoroace