01904 488599
N-Methyl-N-Trimethylsilyltrifluoroaceta
£211.85 Each (ex VAT)
N-Methyl-N-Trimethylsilyltrifluoroaceta
| Product Code | 12124-5ML-F |
|---|---|
| Unit of Measure | 1X5ML |
| CAS Number | 24589-78-4 |
| MDL NUMBER | MFCD00000411 |
| Synonyms | N-Methyl-N-Trimethylsilyltrifluoroacetamide Imidazole Mixture; Mstfa Activated Iii |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12000000 |
| ADRSuff | C |
| CAS Number | 24589-78-4 |
| ADR Hazard Labels | 3 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 30 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Flammable liquid, n.o.s. |
| ADRNo | 1993 |
| Storage Temperature | 2-8C |
| Flash Point | 26 C - closed cup - Solvent |
| GHS Categories | Flam. Liq. 3,Skin Irrit. 2,Eye Dam. 1,STOT SE 3,Repr. 1B |
| GHS Hazard Codes | H226-H315-H318-H335-H360D |
| GHS Hazard Statements | Flammable liquid and vapour. Causes skin irritation. Causes serious eye damage. May cause respiratory irritation. May damage the unborn child. |
| GHS Pictograms | GHS02,GHS08,GHS05,GHS07 |
| GHS Precaution Codes | P201 - P261 - P280 - P305 + P351 + P338 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00000411 |
| Net Weight | 5.415 |
| R-Phrases | 61-10-36/37/38 |
| S-Phrases | 53-26-45 |
| Synonyms | N-Methyl-N-trimethylsilyltrifluoroacetamide imidazole mixture; MSTFA activated III |
| Tariff Number | 29319000900 |
| Technical Name | N-METHYL-N-TRIMETHYLSILYLTRIFLUOROACETAMIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=12124brand=SIAL |
| reaction suitability | reagent type: derivatization reagentreaction type: Silylations |
| storage temp. | 2-8C |
| refractive index | n20/D 1.383 |
| quality | LiChropur(TM) |
| InChI | 1S/C6H12F3NOSi/c1-10(12(2,3)4)5(11)6(7,8)9/h1-4H3 |
| technique(s) | gas chromatography (GC): suitable |
| grade | for GC derivatization |
| SMILES string | CN(C(=O)C(F)(F)F)[Si](C)(C)C |
| InChI key | MSPCIZMDDUQPGJ-UHFFFAOYSA-N |
| Quality Level | 100 |
Description
N-Methyl-N-Trimethylsilyltrifluoroaceta