From £842.40 per (ex VAT)
O-Cresolphthalein Complexone
| Product Code | P5631-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 2411-89-4 |
| MDL NUMBER | MFCD00005911 |
| EMPIRICAL FORMULA | C32H32N2O12 |
| Molecular Weight | 636.6 |
| Synonyms | O-Cresolphthalein-3',3''-Bis-Methyleneiminodiacetic Acid; O-Cresolphthalexon; Metal Phthalein; Phthalein Purple; Xylenylphthalein-Bisiminodiacetic Acid |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - P5631-100G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £959.40 |
| 12+ | 20% | £936.00 |
| 36+ | 22% | £912.60 |
| 72+ | 28% | £842.40 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 2411-89-4 |
| Storage Temperature | room temp |
| EINECSNo | 219-318-8 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a dangerous substance according to GHS. |
| GHS Signal Words | - |
| MDL Number | MFCD00005911 |
| Melting Point | 181-185 C (dec.) (lit.) |
| Molecular Formula | C32H32N2O12 |
| Molecular Weight | 636.6 |
| Net Weight | 100 |
| Synonyms | o-Cresolphthalein-3',3''-bis-methyleneiminodiacetic acid; o-Cresolphthalexon; Metal phthalein; Phthalein purple; Xylenylphthalein-bisiminodiacetic acid |
| Tariff Number | 29322090900 |
| InChI | 1S/C32H32N2O12/c1-17-7-21(9-19(29(17)43)11-33(13-25(35)36)14-26(37)38)32(24-6-4-3-5-23(24)31(45)46-32)22-8-18(2)30(44)20(10-22)12-34(15-27(39)40)16-28(41)42/h3-10,43-44H,11-16H2,1-2H3,(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| Quality Level | 200 |
| InChI key | IYZPEGVSBUNMBE-UHFFFAOYSA-N |
| solubility | NaOH: 50 mg/mL |
| storage temp. | room temp |
| mp | 181-185 C (dec.) (lit.) |
| form | powder |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| SMILES string | Cc1cc(cc(CN(CC(O)=O)CC(O)=O)c1O)C2(OC(=O)c3ccccc23)c4cc(C)c(O)c(CN(CC(O)=O)CC(O)=O)c4 |
| color | white to off-white |
Description
O-Cresolphthalein Complexone