P-Hydroxymercuribenzoic Acid Sodium Salt
From £95.80 per (ex VAT)
P-Hydroxymercuribenzoic Acid Sodium Salt
| Product Code | 55540-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 138-85-2 |
| MDL NUMBER | MFCD00002527 |
| EMPIRICAL FORMULA | C7H5HgNaO3 |
| Molecular Weight | 360.69 |
| Synonyms | P-Chloromercuribenzoate; P-Hydroxymercuribenzoic Acid Sodium Salt; Pcmb; Sodium 4-(Hydroxymercurio)Benzoate |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | B |
| CAS Number | 138-85-2 |
| ADR Hazard Labels | 6.1 |
| ADR Number of Danger | 60 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Mercury compound, solid, n.o.s. |
| ADRNo | 2025 |
| EINECSNo | 205-340-5 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 2,Acute Tox. 1,Acute Tox. 2,STOT RE 2,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H300-H310-H330-H373-H400-H410 |
| GHS Pictograms | GHS06,GHS08,GHS09 |
| GHS Precaution Codes | P260 - P262 - P280 - P301 + P330 + P331 + P310 - P302 + P352 + P310 - P304 + P340 + P310 |
| GHS Signal Words | Danger |
| Hazard Symbols | T+,N |
| Hazard Symbols Descriptions | Very toxic, Dangerous for the environment |
| MDL Number | MFCD00002527 |
| Melting Point | >=300 C |
| Molecular Formula | C7H5HgNaO3 |
| Molecular Weight | 360.69 |
| GHS Hazard Statements | Fatal if swallowed. Fatal in contact with skin. Fatal if inhaled. May cause damage to organs through prolonged or repeated exposure. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Precaution Statements | Do not breathe dust/ fume/ gas/ mist/ vapours/ spray. Wash hands thoroughly after handling. Avoid release to the environment. Wear protective gloves/ protective clothing. Wear respiratory protection. IF SWALLOWED: Immediately call a POISON CENTER or docto |
| Net Weight | 5 |
| R-Phrases | 26/27/28-33-50/53 |
| RTECSNo | OV8150000 |
| S-Phrases | 13-28-36-45-60-61 |
| Synonyms | p-Chloromercuribenzoate; p-Hydroxymercuribenzoic acid sodium salt; PCMB; Sodium 4-(hydroxymercurio)benzoate |
| Tariff Number | 28521000000 |
| Technical Name | SODIUM P-HYDROXYMERCURIOBENZOATE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=55540brand=SIGMA |
| InChI | 1S/C7H5O2.Hg.Na.H2O/c8-7(9)6-4-2-1-3-5-6;;;/h2-5H,(H,8,9);;;1H2/q;2*+1;/p-2 |
| Quality Level | 100 |
| mp | >=300 C |
| SMILES string | [Na+].O[Hg]c1ccc(cc1)C([O-])=O |
| InChI key | CBELQCYFTSHKPJ-UHFFFAOYSA-L |
| Assay | >=95.0% (Hg) |
Description
P-Hydroxymercuribenzoic Acid Sodium Salt