01904 488599
Pentafluoropropionic Anhydride, 99%,
From £100.10 per (ex VAT)
Pentafluoropropionic Anhydride, 99%,
| Product Code | 394904-5ML |
|---|---|
| Unit of Measure | 1X5ML |
| CAS Number | 356-42-3 |
| MDL NUMBER | MFCD00000429 |
| EMPIRICAL FORMULA | C6HFO3 |
| Molecular Weight | 310.05 |
| Synonyms | Pfpa; Perfluoropropionic Anhydride |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12000000 |
| ADRSuff | B |
| CAS Number | 356-42-3 |
| ADR Hazard Labels | 8 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 80 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 8 |
| ADR Proper Shipping Name | Corrosive liquid, acidic, organic, n.o.s. |
| ADRNo | 3265 |
| Boiling Point | 69-70 C/735 mmHg (lit.) |
| Density | 1.571 g/mL at 25 C (lit.) |
| EINECSNo | 206-604-2 |
| Flash Point | Not applicable |
| GHS Categories | Skin Corr. 1B |
| GHS Hazard Codes | H314 |
| GHS Hazard Statements | Causes severe skin burns and eye damage. |
| GHS Pictograms | GHS05 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 - P310 |
| GHS Precaution Statements | Wear protective gloves/ protective clothing/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/ phys |
| GHS Signal Words | Danger |
| Hazard Symbols | C |
| Hazard Symbols Descriptions | Corrosive |
| MDL Number | MFCD00000429 |
| Molecular Formula | C6HFO3 |
| Molecular Weight | 310.05 |
| Net Weight | 7.855 |
| R-Phrases | 14-34 |
| S-Phrases | 26-36/37/39-45 |
| Synonyms | PFPA; Perfluoropropionic anhydride |
| Tariff Number | 29159070900 |
| Technical Name | PENTAFLUOROPROPIONIC ANHYDRIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=394904brand=SIAL |
| InChI key | XETRHNFRKCNWAJ-UHFFFAOYSA-N |
| reaction suitability | reagent type: derivatization reagentreaction type: Acylations |
| quality | LiChropur(TM) |
| Assay | 99% |
| form | liquid |
| technique(s) | gas chromatography (GC): suitable |
| grade | for GC derivatization |
| bp | 69-70 C/735 mmHg (lit.) |
| Quality Level | 100 |
| InChI | 1S/C6F10O3/c7-3(8,5(11,12)13)1(17)19-2(18)4(9,10)6(14,15)16 |
| SMILES string | FC(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)F |
Description
Pentafluoropropionic Anhydride, 99%,