01904 488599
Phenol Red Sodium
From £99.36 per (ex VAT)
Phenol Red Sodium
| Product Code | P4758-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 34487-61-1 |
| MDL NUMBER | MFCD00066901 |
| EMPIRICAL FORMULA | C19H13NaO5S |
| Molecular Weight | 376.36 |
| Synonyms | Phenolsulfonephthalein Sodium Salt |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - P4758-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £113.16 |
| 12+ | 20% | £110.40 |
| 36+ | 22% | £107.64 |
| 72+ | 28% | £99.36 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 34487-61-1 |
| Storage Temperature | room temp |
| EINECSNo | 252-057-8 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | - |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00066901 |
| Melting Point | 285 C (dec.) (lit.) |
| Molecular Formula | C19H13NaO5S |
| Molecular Weight | 376.36 |
| Net Weight | 25 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | Phenolsulfonephthalein sodium salt |
| Tariff Number | 29349990900 |
| Quality Level | 200 |
| InChI key | HKHYOKBQJILTEI-UHFFFAOYSA-M |
| storage temp. | room temp |
| SMILES string | [Na+].Oc1ccc(cc1)C2(OS(=O)(=O)c3ccccc23)c4ccc([O-])cc4 |
| epsilonmax | 31.62 at 423 nm in 0.1 M phosphate buffer |
| InChI | 1S/C19H14O5S.Na/c20-15-9-5-13(6-10-15)19(14-7-11-16(21)12-8-14)17-3-1-2-4-18(17)25(22,23)24-19;/h1-12,20-21H;/q;+1/p-1 |
| solubility | water: 1 mg/mL, opaque, dark red |
| form | powder |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| mp | 285 C (dec.) (lit.) |
| technique(s) | titration: suitable |
| visual transition interval | 6.8-8.2, yellow to red |
Description
Phenol Red Sodium