01904 488599
Rhodamine B, >=95 % (Hplc)
From £19.59 per (ex VAT)
Rhodamine B, >=95 % (Hplc)
| Product Code | R6626-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 81-88-9 |
| MDL NUMBER | MFCD00011931 |
| EMPIRICAL FORMULA | C28H31ClN2O3 |
| Molecular Weight | 479.01 |
| Synonyms | Basic Violet 10; Brilliant Pink B; Rhodamine O; Tetraethylrhodamine |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - R6626-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £20.53 |
| 12+ | 15% | £20.06 |
| 36+ | 17% | £19.59 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 81-88-9 |
| Storage Temperature | room temp |
| EINECSNo | 201-383-9 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Eye Dam. 1,Aquatic Chronic 3 |
| GHS Hazard Codes | H302-H318-H412 |
| GHS Hazard Statements | Harmful if swallowed. Causes serious eye damage. Harmful to aquatic life with long lasting effects. |
| GHS Pictograms | GHS05,GHS07 |
| GHS Precaution Codes | P273 - P280 - P305 + P351 + P338 |
| GHS Precaution Statements | Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00011931 |
| Melting Point | 210-211 (dec.) (lit.) |
| Molecular Formula | C28H31ClN2O3 |
| Molecular Weight | 479.01 |
| Net Weight | 25 |
| R-Phrases | 22-41-52/53 |
| RTECSNo | BP3675000 |
| S-Phrases | 26-39 |
| Synonyms | Basic Violet 10; Brilliant Pink B; Rhodamine O; Tetraethylrhodamine |
| Tariff Number | 32129000000 |
| mp | 210-211 (dec.) (lit.) |
| SMILES string | [Cl-].CCN(CC)c1ccc2c(OC3=CC(C=CC3=C2c4ccccc4C(O)=O)=[N+](/CC)CC)c1 |
| Quality Level | 200 |
| Assay | >=95% (HPLC) |
| epsilon (extinction coefficient) | 104500-115800 at 542-554 nm in methanol |
| storage temp. | room temp |
| form | powder |
| InChI key | PYWVYCXTNDRMGF-UHFFFAOYSA-N |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| solubility | H2O: 1 mg/mL |
| InChI | 1S/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H,5-8H2,1-4H3;1H |
Description
Rhodamine B, >=95 % (Hplc)