01904 488599
Sodium Deoxycholate Bioxtra, >= 98.
From £54.29 per (ex VAT)
Sodium Deoxycholate Bioxtra, >= 98.
| Product Code | 30970-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 302-95-4 |
| MDL NUMBER | MFCD00064139 |
| EMPIRICAL FORMULA | C24H39NaO4 |
| Molecular Weight | 414.55 |
| Synonyms | 3Alpha,12Alpha-Dihydroxy-5Beta-Cholanic Acid Sodium Salt; 7-Deoxycholic Acid Sodium Salt; Desoxycholic Acid Sodium Salt |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12161900 |
| ADRSuff | 1 |
| CAS Number | 302-95-4 |
| EINECSNo | 206-132-7 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4 |
| GHS Hazard Codes | H302 |
| GHS Hazard Statements | Harmful if swallowed. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P301 + P312 + P330 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00064139 |
| Molecular Formula | C24H39NaO4 |
| Molecular Weight | 414.55 |
| Net Weight | 25 |
| R-Phrases | 22-37 |
| RTECSNo | FZ2250000 |
| Synonyms | 3alpha,12alpha-Dihydroxy-5beta-cholanic acid sodium salt; 7-Deoxycholic acid sodium salt; Desoxycholic acid sodium salt |
| Tariff Number | 29181930900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=30970brand=SIGMA |
| Quality Level | 300 |
| cation traces | Mg: <=10 mg/kg |
| CMC | 2-6 mM (20-25C) |
| InChI key | FHHPUSMSKHSNKW-SMOYURAASA-M |
| technique(s) | DNA purification: suitable |
| Assay | >=98.0% (dry matter, NT) |
| functional group | carboxylic acid |
| biological source | ox bile |
| description | anionic |
| form | powder |
| mol wt | micellar avg mol wt 1200-5000 |
| impurities | <=1% cholic acid (HPLC) |
| optical activity | [alpha]20/D +44+/-2, c = 2% in H2O |
| SMILES string | [Na+].[H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@H]([C@H](C)CCC([O-])=O)[C@@]4(C)[C@@H](O)C[C@]3([H])[C@@]1(C)CC[C@@H](O)C2 |
| solubility | water: soluble 1 gm in 10 ml, clear, colorless to very faintly yellow |
| Aggregation Number | 3-12 |
| product line | BioXtra |
| InChI | 1S/C24H40O4.Na/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3;/h14-21,25-26H,4-13H2,1-3H3,(H,27,28);/q;+1/p-1/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-;/m1./s1 |
| HLB | 16 |
Description
Sodium Deoxycholate Bioxtra, >= 98.