01904 488599
Tbuxphos, 98%
From £291.92 per (ex VAT)
Tbuxphos, 98%
| Product Code | 638080-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 564483-19-8 |
| MDL NUMBER | MFCD06411306 |
| EMPIRICAL FORMULA | C29H45P |
| Molecular Weight | 424.64 |
| Synonyms | Tbuxphos; 2-Di-Tert-Butylphosphino-2',4',6'-Triisopropylbiphenyl; T-Bu Xphos; Tert-Butyl Xphos |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 638080-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £327.52 |
| 12+ | 10% | £320.40 |
| 36+ | 12% | £313.28 |
| 72+ | 18% | £291.92 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 564483-19-8 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a dangerous substance according to GHS. |
| GHS Signal Words | - |
| MDL Number | MFCD06411306 |
| Melting Point | 148-151 C (lit.) |
| Molecular Formula | C29H45P |
| Molecular Weight | 424.64 |
| Net Weight | 5 |
| Purity Grade | 0.98 |
| Synonyms | tBuXPhos; 2-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl; t-Bu XPhos; tert-Butyl XPhos |
| Tariff Number | 29313990900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=638080brand=ALDRICH |
| Quality Level | 300 |
| InChI key | SACNIGZYDTUHKB-UHFFFAOYSA-N |
| reaction suitability | reagent type: ligandreaction type: Buchwald-Hartwig Cross Coupling Reaction |
| InChI | 1S/C29H45P/c1-19(2)22-17-24(20(3)4)27(25(18-22)21(5)6)23-15-13-14-16-26(23)30(28(7,8)9)29(10,11)12/h13-21H,1-12H3 |
| SMILES string | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c2ccccc2P(C(C)(C)C)C(C)(C)C |
| greener alternative product characteristics | Atom EconomyDesign for Energy EfficiencyUse of Renewable FeedstocksLearn more about the Principles of Green Chemistry. |
| mp | 148-151 C (lit.) |
| functional group | phosphine |
| form | solid |
| Assay | 98% |
| greener alternative category | Re-engineered |
| greener alternative product score | old score: 12new score: 1Find out more about DOZN(TM) Scoring |
Description
Tbuxphos, 98%