Tetrabutylammonium Fluoride, 1.0M Soluti
From £836.40 per (ex VAT)
Tetrabutylammonium Fluoride, 1.0M Soluti
| Product Code | 216143-2.5L |
|---|---|
| Unit of Measure | 1X2.5LT |
| CAS Number | 429-41-4 |
| MDL NUMBER | MFCD00011747 |
| EMPIRICAL FORMULA | C16H36FN |
| Molecular Weight | 261.46 |
| Synonyms | Tbaf Solution |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352000 |
| ADRSuff | BB |
| CAS Number | 429-41-4 |
| ADR Hazard Labels | 3 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Flammable liquid, corrosive, n.o.s. |
| ADR SubHaz Classes | 8 |
| ADRNo | 2924 |
| Storage Temperature | 2-8C |
| Density | 0.903 g/mL at 25 C |
| Flash Point | -17 C - closed cup |
| GHS Categories | Flam. Liq. 2,Acute Tox. 4,Skin Corr. 1B,STOT SE 3,Carc. 2 |
| GHS Hazard Codes | H225-H302-H314-H335-H351 |
| GHS Hazard Statements | Highly flammable liquid and vapour. Harmful if swallowed. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. |
| GHS Pictograms | GHS02,GHS08,GHS05,GHS07 |
| GHS Precaution Codes | P210 - P260 - P280 - P305 + P351 + P338 - P370 + P378 - P403 + P235 |
| GHS Signal Words | Danger |
| Hazard Symbols | F,C |
| Hazard Symbols Descriptions | Highly flammable, Corrosive |
| MDL Number | MFCD00011747 |
| Molecular Formula | C16H36FN |
| Molecular Weight | 261.46 |
| Net Weight | 2.258 |
| R-Phrases | 11-19-34-37-40 |
| S-Phrases | 16-26-36/37/39-45 |
| Synonyms | TBAF solution |
| Tariff Number | 38249992990 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=216143brand=ALDRICH |
| Quality Level | 200 |
| form | liquid |
| InChI key | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| SMILES string | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | 1S/C16H36N.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| storage temp. | 2-8C |
| impurities | ~5 wt. % water |
| concentration | 1.0 M in THF |
Description
Tetrabutylammonium Fluoride, 1.0M Soluti