01904 488599
Thymidine 5′-Triphosphate Sodium 100 Mm
From £206.64 per (ex VAT)
Thymidine 5′-Triphosphate Sodium 100 Mm
| Product Code | T9656-.1MMO |
|---|---|
| Unit of Measure | 1X0.1MMO |
| CAS Number | 18377 |
| Synonyms | TTP |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | DICE |
| UNSPSC Code | 41106305 |
| ADRSuff | 1 |
| CAS Number | 18423-43-3 |
| Storage Temperature | -20C |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a hazardous substance or mixture according to Regulation (EC) No 1272/2008 |
| GHS Signal Words | - |
| MDL Number | MFCD00080338 |
| Net Weight | 1.1 |
| Synonyms | TTP |
| Tariff Number | 29349990900 |
| foreign activity | DNase, RNase, none detected |
| Quality Level | 200 |
| concentration | 100 mM in H2O |
| form | liquid |
| shipped in | dry ice |
| InChI key | KAELIXTVSANDSE-UHFFFAOYSA-N |
| Assay | >=99% |
| InChI | 1S/C10H17N2O14P3.Na.H/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(24-8)4-23-28(19,20)26-29(21,22)25-27(16,17)18;;/h3,6-8,13H,2,4H2,1H3,(H,19,20)(H,21,22)(H,11,14,15)(H2,16,17,18);; |
| color | colorless |
| SMILES string | [Na].CC1=CN(C2CC(O)C(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O2)C(=O)NC1=O |
| storage temp. | -20C |
| UNSPSC | 41106305 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=T9656brand=SIGMA |
| Molecular Weight | 0.0000 |
Description
Thymidine 5'-Triphosphate Sodium 100 Mm