Tris Edta Buffer Solution, Bioultra, For
From £78.39 per (ex VAT)
Tris Edta Buffer Solution, Bioultra, For
| Product Code | 93283-500ML |
|---|---|
| Unit of Measure | 1X500ML |
| MDL NUMBER | MFCD00236359 |
| Synonyms | Te Buffer Solution |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 93283-500ML
| Qty | Discount | Price |
|---|---|---|
| 4+ | 24% | £88.92 |
| 12+ | 26% | £86.58 |
| 36+ | 28% | £84.24 |
| 72+ | 33% | £78.39 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12161700 |
| ADRSuff | 1 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a hazardous substance or mixture according to Regulation (EC) No. 1272/2008. |
| GHS Signal Words | - |
| MDL Number | MFCD00236359 |
| Net Weight | 500 |
| Synonyms | TE buffer solution |
| Tariff Number | 38249992990 |
| pH | 8.0+/-0.2 (25 C) |
| cation traces | Cd: <=1 mg/kg |
| Quality Level | 200 |
| impurities | phosphatases, none detected |
| lambda | neat |
| form | liquid |
| UV absorption | lambda: 280 nm Amax: 0.01 |
| product line | BioUltra |
| grade | for molecular biology |
| InChI | 1S/C10H16N2O8.C4H11NO3/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;5-4(1-6,2-7)3-8/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);6-8H,1-3,5H2 |
| InChI key | VLEIUWBSEKKKFX-UHFFFAOYSA-N |
| SMILES string | NC(CO)(CO)CO.OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Description
Tris Edta Buffer Solution, Bioultra, For