(+)-Carvone, Terpene Standard
From £152.51 per (ex VAT)
(+)-Carvone, Terpene Standard
| Product Code | 22070-100ML |
|---|---|
| Unit of Measure | 1X100ML |
| CAS Number | 2244-16-8 |
| MDL NUMBER | MFCD00062997 |
| EMPIRICAL FORMULA | CH14O |
| Molecular Weight | 150.22 |
| Synonyms | (+)-P-Mentha-6,8-Diene 2-One; (S)-5-Isopropenyl-2-Methyl-2-Cyclohexenone |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 2244-16-8 |
| Boiling Point | 228-230 C (lit.) |
| Density | 0.960 g/mL at 20 C (lit.) |
| EINECSNo | 218-827-2 |
| Flash Point | 89 C - closed cup |
| GHS Categories | Skin Sens. 1 |
| GHS Hazard Codes | H317 |
| GHS Hazard Statements | May cause an allergic skin reaction. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P280 |
| GHS Remarks | Not a hazardous substance or mixture according to Regulation (EC) No. 1272/2008. |
| GHS Signal Words | Warning |
| MDL Number | MFCD00062997 |
| Molecular Formula | CH14O |
| Molecular Weight | 150.22 |
| Net Weight | 96 |
| Synonyms | (+)-p-Mentha-6,8-diene 2-one; (S)-5-Isopropenyl-2-methyl-2-cyclohexenone |
| Tariff Number | 29142900900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=22070brand=SIAL |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC(=C)[C@H]1CC=C(C)C(=O)C1 |
| InChI | 1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m0/s1 |
| refractive index | n20/D 1.499 |
| Assay | >=98.5% (sum of enantiomers, GC) |
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| grade | analytical standard |
| bp | 228-230 C (lit.) |
| Quality Level | 100 |
| Application(s) | agricultureenvironmentalfood and beverages |
| optical activity | [alpha]20/D +61+/-2, neat |
| InChI key | ULDHMXUKGWMISQ-VIFPVBQESA-N |
Description
(+)-Carvone, Terpene Standard