01904 488599
Leucoberbelin Blue I
From £256.00 per (ex VAT)
Leucoberbelin Blue I
| Product Code | 432199-500MG |
|---|---|
| Unit of Measure | 1X500MG |
| CAS Number | 52748-86-4 |
| MDL NUMBER | MFCD00217522 |
| EMPIRICAL FORMULA | C23H26N2O3S |
| Molecular Weight | 410.53 |
| Synonyms | Lbb |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | B |
| CAS Number | 52748-86-4 |
| ADR Hazard Labels | 8 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 80 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 8 |
| ADR Proper Shipping Name | Corrosive solid, acidic, organic, n.o.s. |
| ADRNo | 3261 |
| Storage Temperature | room temp |
| Flash Point | Not applicable |
| GHS Categories | Skin Corr. 1B |
| GHS Hazard Codes | H314 |
| GHS Hazard Statements | Causes severe skin burns and eye damage. |
| GHS Pictograms | GHS05 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 - P310 |
| GHS Precaution Statements | Wear protective gloves/ protective clothing/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/ phys |
| GHS Signal Words | Danger |
| Hazard Symbols | C |
| Hazard Symbols Descriptions | Corrosive |
| MDL Number | MFCD00217522 |
| Melting Point | >300 C (lit.) |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.53 |
| Net Weight | 500 |
| R-Phrases | 34 |
| S-Phrases | 26-36/37/39-45 |
| Synonyms | LBB |
| Tariff Number | 32129000000 |
| Technical Name | LEUCOBERBELIN BLUE I |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=432199brand=ALDRICH |
| InChI key | MCKLFIWDQVFMEK-UHFFFAOYSA-N |
| InChI | 1S/C23H26N2O3S/c1-24(2)19-13-9-17(10-14-19)23(18-11-15-20(16-12-18)25(3)4)21-7-5-6-8-22(21)29(26,27)28/h5-16,23H,1-4H3,(H,26,27,28) |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| lambdamax | 253 nm |
| mp | >300 C (lit.) |
| form | powder |
| solubility | water: 50 g/L |
| Composition | Dye content, 65% |
| SMILES string | CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)c3ccccc3S(O)(=O)=O |
Description
Leucoberbelin Blue I